CAS 1372980-56-7 is the registry number for Mesocarb Hydroxysulfate. Offered by: TRC. Available pack sizes: 25mg.
[4-[[3-(1-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]carbamoylamino]phenyl] sulfate (CAS 1372980-56-7) is a chemical compound with the molecular formula C18H18N4O6S and a molecular weight of 418.4 g/mol. IUPAC name: [4-[[3-(1-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]carbamoylamino]phenyl] sulfate. InChIKey: MAVQZPVDXYEGCQ-UHFFFAOYSA-N.
| Molecular formula | C18H18N4O6S |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | [4-[[3-(1-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]carbamoylamino]phenyl] sulfate |
| InChIKey | MAVQZPVDXYEGCQ-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=CC=C1)[N+]2=NOC(=C2)NC(=O)NC3=CC=C(C=C3)OS(=O)(=O)[O-] |
Computed by PubChem (NCBI)