CAS 137308-86-2 is the registry number for Diphenyliodanium 9,10-dimethoxyanthracene-2-sulfonate. Offered by: Biosynth. Available pack sizes: 10g, 25g, 50g, 100g.
9,10-dimethoxyanthracene-2-sulfonate;diphenyliodanium (CAS 137308-86-2) is a chemical compound with the molecular formula C28H23IO5S and a molecular weight of 598.4 g/mol. IUPAC name: 9,10-dimethoxyanthracene-2-sulfonate;diphenyliodanium. InChIKey: ZMCBPOWGXHULPT-UHFFFAOYSA-M.
| Molecular formula | C28H23IO5S |
|---|---|
| Molecular weight | 598.4 g/mol |
| IUPAC name | 9,10-dimethoxyanthracene-2-sulfonate;diphenyliodanium |
| InChIKey | ZMCBPOWGXHULPT-UHFFFAOYSA-M |
| SMILES | COC1=C2C=CC(=CC2=C(C3=CC=CC=C31)OC)S(=O)(=O)[O-].C1=CC=C(C=C1)[I+]C2=CC=CC=C2 |
Computed by PubChem (NCBI)