CAS 1373205-41-4 appears in our catalog under these names: Glyphosphate-FMOC, Glyphosphate-FMOC, >95% (HPLC), Glyphosate-FMOC, Fmoc-Glyphosate. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: on request, 100mg, 10mg, 50mg, 1x50mg.
2-[9H-fluoren-9-ylmethoxycarbonyl(phosphonomethyl)amino]acetic acid (CAS 1373205-41-4) is a chemical compound with the molecular formula C18H18NO7P and a molecular weight of 391.3 g/mol. IUPAC name: 2-[9H-fluoren-9-ylmethoxycarbonyl(phosphonomethyl)amino]acetic acid. InChIKey: VJROATGKXPCGPH-UHFFFAOYSA-N.
| Molecular formula | C18H18NO7P |
|---|---|
| Molecular weight | 391.3 g/mol |
| IUPAC name | 2-[9H-fluoren-9-ylmethoxycarbonyl(phosphonomethyl)amino]acetic acid |
| InChIKey | VJROATGKXPCGPH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N(CC(=O)O)CP(=O)(O)O |
Computed by PubChem (NCBI)