CAS 1373232-65-5 is the registry number for 3-[4-Fluoro-3-(trifluoromethyl)phenyl]aniline hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
3-[4-fluoro-3-(trifluoromethyl)phenyl]aniline;hydrochloride (CAS 1373232-65-5) is a chemical compound with the molecular formula C13H10ClF4N and a molecular weight of 291.67 g/mol. IUPAC name: 3-[4-fluoro-3-(trifluoromethyl)phenyl]aniline;hydrochloride. InChIKey: XKWXAYVIPJOYBB-UHFFFAOYSA-N.
| Molecular formula | C13H10ClF4N |
|---|---|
| Molecular weight | 291.67 g/mol |
| IUPAC name | 3-[4-fluoro-3-(trifluoromethyl)phenyl]aniline;hydrochloride |
| InChIKey | XKWXAYVIPJOYBB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CC(=C(C=C2)F)C(F)(F)F.Cl |
Computed by PubChem (NCBI)