CAS 1373233-35-2 appears in our catalog under these names: 3-(FLUOROSULFONYL)-2-THIOPHENECARBOXYLI&, Methyl 3-(fluorosulfonyl)thiophene-2-carboxylate, 95%. Offered by: Sigma-Aldrich, Combi-blocks. Available pack sizes: 1G, 10g, 5g.
Methyl 3-fluorosulfonylthiophene-2-carboxylate (CAS 1373233-35-2) is a chemical compound with the molecular formula C6H5FO4S2 and a molecular weight of 224.2 g/mol. IUPAC name: methyl 3-fluorosulfonylthiophene-2-carboxylate. InChIKey: YLQWEWBWWLVJOT-UHFFFAOYSA-N.
| Molecular formula | C6H5FO4S2 |
|---|---|
| Molecular weight | 224.2 g/mol |
| IUPAC name | methyl 3-fluorosulfonylthiophene-2-carboxylate |
| InChIKey | YLQWEWBWWLVJOT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CS1)S(=O)(=O)F |
Computed by PubChem (NCBI)