CAS 1373233-37-4 appears in our catalog under these names: 2-Fluoro-5-(fluorosulfonyl)benzoic acid, 95%, 95%, 2-FLUORO-5-(FLUOROSULFONYL)BENZOIC ACID, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
2-fluoro-5-fluorosulfonylbenzoic acid (CAS 1373233-37-4) is a chemical compound with the molecular formula C7H4F2O4S and a molecular weight of 222.17 g/mol. IUPAC name: 2-fluoro-5-fluorosulfonylbenzoic acid. InChIKey: QZUODPSUJVCAQE-UHFFFAOYSA-N.
| Molecular formula | C7H4F2O4S |
|---|---|
| Molecular weight | 222.17 g/mol |
| IUPAC name | 2-fluoro-5-fluorosulfonylbenzoic acid |
| InChIKey | QZUODPSUJVCAQE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)F)C(=O)O)F |
Computed by PubChem (NCBI)