CAS 1373243-86-7 appears in our catalog under these names: N5-Methyllamotrigine, >95% (HPLC), N5-Methyllamotrigine. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 5mg, 25mg, 10mg, 50mg.
6-(2,3-dichlorophenyl)-5-N-methyl-1,2,4-triazine-3,5-diamine (CAS 1373243-86-7) is a chemical compound with the molecular formula C10H9Cl2N5 and a molecular weight of 270.12 g/mol. IUPAC name: 6-(2,3-dichlorophenyl)-5-N-methyl-1,2,4-triazine-3,5-diamine. InChIKey: WVJYMSFBMQWMAL-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2N5 |
|---|---|
| Molecular weight | 270.12 g/mol |
| IUPAC name | 6-(2,3-dichlorophenyl)-5-N-methyl-1,2,4-triazine-3,5-diamine |
| InChIKey | WVJYMSFBMQWMAL-UHFFFAOYSA-N |
| SMILES | CNC1=C(N=NC(=N1)N)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)