Products 1373253-22-5

CAS 1373253-22-5 is the registry number for Methyl morpholine-2-carboxylate 2,2,2-trifluoroacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

Methyl morpholine-2-carboxylate;2,2,2-trifluoroacetic acid (CAS 1373253-22-5) is a chemical compound with the molecular formula C8H12F3NO5 and a molecular weight of 259.18 g/mol. IUPAC name: methyl morpholine-2-carboxylate;2,2,2-trifluoroacetic acid. InChIKey: MEZYADQKFXKWSH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12F3NO5
Molecular weight259.18 g/mol
IUPAC namemethyl morpholine-2-carboxylate;2,2,2-trifluoroacetic acid
InChIKeyMEZYADQKFXKWSH-UHFFFAOYSA-N
SMILESCOC(=O)C1CNCCO1.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)