CAS 1373432-09-7 appears in our catalog under these names: (S)-BI-DIME, 97%, (S)–3–(t–Butyl)–4–(2,6–dimethoxyphenyl)–2,3–dihydrobenzo(d)(1,3)oxaphosphole, (S)-BIDIME 97%, (S)-BIDIME, (S)-3-(tert-Butyl)-4-(2,6-dimethoxyphenyl)-2,3-dihydrobenzo[d][1,3]oxaphosphole, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg, 5g, 10g.
(3S)-3-tert-butyl-4-(2,6-dimethoxyphenyl)-2H-1,3-benzoxaphosphole (CAS 1373432-09-7) is a chemical compound with the molecular formula C19H23O3P and a molecular weight of 330.4 g/mol. IUPAC name: (3S)-3-tert-butyl-4-(2,6-dimethoxyphenyl)-2H-1,3-benzoxaphosphole. InChIKey: BWPDUHMFZCEKIP-HSZRJFAPSA-N.
| Molecular formula | C19H23O3P |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | (3S)-3-tert-butyl-4-(2,6-dimethoxyphenyl)-2H-1,3-benzoxaphosphole |
| InChIKey | BWPDUHMFZCEKIP-HSZRJFAPSA-N |
| SMILES | CC(C)(C)[P@@]1COC2=CC=CC(=C21)C3=C(C=CC=C3OC)OC |
Computed by PubChem (NCBI)