Products 1373438-98-2
CAS 1373438-98-2 is the registry number for 1-(7-Fluoro-1H-indol-2-yl)ethanone, 97%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 50mg.
1-(7-fluoro-1H-indol-2-yl)ethanone (CAS 1373438-98-2) is a chemical compound with the molecular formula C10H8FNO and a molecular weight of 177.17 g/mol. IUPAC name: 1-(7-fluoro-1H-indol-2-yl)ethanone. InChIKey: HYPSCSNQQWADEW-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO |
|---|---|
| Molecular weight | 177.17 g/mol |
| IUPAC name | 1-(7-fluoro-1H-indol-2-yl)ethanone |
| InChIKey | HYPSCSNQQWADEW-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(N1)C(=CC=C2)F |
Computed by PubChem (NCBI)