CAS 1373503-19-5 is the registry number for 1-tert-Butyl 3-methyl 4-(trifluoromethyl)-5,6-dihydropyridine-1,3(4H)-dicarboxylate, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
1-O-tert-butyl 5-O-methyl 4-(trifluoromethyl)-3,4-dihydro-2H-pyridine-1,5-dicarboxylate (CAS 1373503-19-5) is a chemical compound with the molecular formula C13H18F3NO4 and a molecular weight of 309.28 g/mol. IUPAC name: 1-O-tert-butyl 5-O-methyl 4-(trifluoromethyl)-3,4-dihydro-2H-pyridine-1,5-dicarboxylate. InChIKey: KJSAFCCPLVCJJQ-UHFFFAOYSA-N.
| Molecular formula | C13H18F3NO4 |
|---|---|
| Molecular weight | 309.28 g/mol |
| IUPAC name | 1-O-tert-butyl 5-O-methyl 4-(trifluoromethyl)-3,4-dihydro-2H-pyridine-1,5-dicarboxylate |
| InChIKey | KJSAFCCPLVCJJQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=C1)C(=O)OC)C(F)(F)F |
Computed by PubChem (NCBI)