CAS 13738-63-1 appears in our catalog under these names: Fluoronitrofen, >95% (HPLC), Fluoronitrofen. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 100mg, 250mg, 25mg.
1,5-dichloro-3-fluoro-2-(4-nitrophenoxy)benzene (CAS 13738-63-1) is a chemical compound with the molecular formula C12H6Cl2FNO3 and a molecular weight of 302.08 g/mol. IUPAC name: 1,5-dichloro-3-fluoro-2-(4-nitrophenoxy)benzene. InChIKey: MVHWKYHDYCGNQN-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl2FNO3 |
|---|---|
| Molecular weight | 302.08 g/mol |
| IUPAC name | 1,5-dichloro-3-fluoro-2-(4-nitrophenoxy)benzene |
| InChIKey | MVHWKYHDYCGNQN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2=C(C=C(C=C2Cl)Cl)F |
Computed by PubChem (NCBI)