Products 1373822-39-9
CAS 1373822-39-9 is the registry number for eIF4E-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-[7-[2-(4-chlorophenoxy)ethyl]-2-(methylamino)-6-oxo-1H-purin-8-yl]phenyl]phosphonic acid (CAS 1373822-39-9) is a chemical compound with the molecular formula C20H19ClN5O5P and a molecular weight of 475.8 g/mol. IUPAC name: [4-[7-[2-(4-chlorophenoxy)ethyl]-2-(methylamino)-6-oxo-1H-purin-8-yl]phenyl]phosphonic acid. InChIKey: MCYZBWKMUOPJOU-UHFFFAOYSA-N.
| Molecular formula | C20H19ClN5O5P |
|---|---|
| Molecular weight | 475.8 g/mol |
| IUPAC name | [4-[7-[2-(4-chlorophenoxy)ethyl]-2-(methylamino)-6-oxo-1H-purin-8-yl]phenyl]phosphonic acid |
| InChIKey | MCYZBWKMUOPJOU-UHFFFAOYSA-N |
| SMILES | CNC1=NC2=C(C(=O)N1)N(C(=N2)C3=CC=C(C=C3)P(=O)(O)O)CCOC4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)