CAS 1373864-11-9 appears in our catalog under these names: 5-Chloro-6-(2,2-difluoroethoxy)pyridine-3-carboxylic acid, 95%, 5-Chloro-6-(2,2-difluoroethoxy)pyridine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-chloro-6-(2,2-difluoroethoxy)pyridine-3-carboxylic acid (CAS 1373864-11-9) is a chemical compound with the molecular formula C8H6ClF2NO3 and a molecular weight of 237.59 g/mol. IUPAC name: 5-chloro-6-(2,2-difluoroethoxy)pyridine-3-carboxylic acid. InChIKey: WLNVGQDPQPPZNY-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF2NO3 |
|---|---|
| Molecular weight | 237.59 g/mol |
| IUPAC name | 5-chloro-6-(2,2-difluoroethoxy)pyridine-3-carboxylic acid |
| InChIKey | WLNVGQDPQPPZNY-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)OCC(F)F)C(=O)O |
Computed by PubChem (NCBI)