CAS 1373920-68-3 is the registry number for 2,4-Dibromo-5-(trifluoromethoxy)anisole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,5-dibromo-2-methoxy-4-(trifluoromethoxy)benzene (CAS 1373920-68-3) is a chemical compound with the molecular formula C8H5Br2F3O2 and a molecular weight of 349.93 g/mol. IUPAC name: 1,5-dibromo-2-methoxy-4-(trifluoromethoxy)benzene. InChIKey: MNJSXTGIUDEJSM-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2F3O2 |
|---|---|
| Molecular weight | 349.93 g/mol |
| IUPAC name | 1,5-dibromo-2-methoxy-4-(trifluoromethoxy)benzene |
| InChIKey | MNJSXTGIUDEJSM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1Br)Br)OC(F)(F)F |
Computed by PubChem (NCBI)