CAS 1373920-75-2 is the registry number for 4-Fluoro-3-methyl-5-(trifluoromethyl)phenylacetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[4-fluoro-3-methyl-5-(trifluoromethyl)phenyl]acetonitrile (CAS 1373920-75-2) is a chemical compound with the molecular formula C10H7F4N and a molecular weight of 217.16 g/mol. IUPAC name: 2-[4-fluoro-3-methyl-5-(trifluoromethyl)phenyl]acetonitrile. InChIKey: YKXAXCYASRRQID-UHFFFAOYSA-N.
| Molecular formula | C10H7F4N |
|---|---|
| Molecular weight | 217.16 g/mol |
| IUPAC name | 2-[4-fluoro-3-methyl-5-(trifluoromethyl)phenyl]acetonitrile |
| InChIKey | YKXAXCYASRRQID-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1F)C(F)(F)F)CC#N |
Computed by PubChem (NCBI)