CAS 1373920-80-9 is the registry number for 2-Chloro-5-(pentafluorosulfur)benzyl alcohol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[2-chloro-5-(pentafluoro-lambda6-sulfanyl)phenyl]methanol (CAS 1373920-80-9) is a chemical compound with the molecular formula C7H6ClF5OS and a molecular weight of 268.63 g/mol. IUPAC name: [2-chloro-5-(pentafluoro-lambda6-sulfanyl)phenyl]methanol. InChIKey: YRZHFWSMRASOIL-UHFFFAOYSA-N.
| Molecular formula | C7H6ClF5OS |
|---|---|
| Molecular weight | 268.63 g/mol |
| IUPAC name | [2-chloro-5-(pentafluoro-lambda6-sulfanyl)phenyl]methanol |
| InChIKey | YRZHFWSMRASOIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(F)(F)(F)(F)F)CO)Cl |
Computed by PubChem (NCBI)