Products 1374006-27-5

CAS 1374006-27-5 is the registry number for 2,5-Bis(2-(2-(2-methoxyethoxy)ethoxy)ethoxy)terephthalic acid, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]terephthalic acid (CAS 1374006-27-5) is a chemical compound with the molecular formula C22H34O12 and a molecular weight of 490.5 g/mol. IUPAC name: 2,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]terephthalic acid. InChIKey: FYYGMMFZHDRZLK-UHFFFAOYSA-N.

Identity
Molecular formulaC22H34O12
Molecular weight490.5 g/mol
IUPAC name2,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]terephthalic acid
InChIKeyFYYGMMFZHDRZLK-UHFFFAOYSA-N
SMILESCOCCOCCOCCOC1=CC(=C(C=C1C(=O)O)OCCOCCOCCOC)C(=O)O

Computed by PubChem (NCBI)