CAS 1374128-90-1 is the registry number for Vitacoxib. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-chloro-5-(4-methylphenyl)imidazol-1-yl]-5-methylsulfonylpyridine (CAS 1374128-90-1) is a chemical compound with the molecular formula C16H14ClN3O2S and a molecular weight of 347.8 g/mol. IUPAC name: 2-[4-chloro-5-(4-methylphenyl)imidazol-1-yl]-5-methylsulfonylpyridine. InChIKey: NSWKPXFHCORWAE-UHFFFAOYSA-N.
| Molecular formula | C16H14ClN3O2S |
|---|---|
| Molecular weight | 347.8 g/mol |
| IUPAC name | 2-[4-chloro-5-(4-methylphenyl)imidazol-1-yl]-5-methylsulfonylpyridine |
| InChIKey | NSWKPXFHCORWAE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(N=CN2C3=NC=C(C=C3)S(=O)(=O)C)Cl |
Computed by PubChem (NCBI)