Products 1374145-59-1

CAS 1374145-59-1 is the registry number for tert–butyl 4–(6–bromo–1H–benzo(d)imidazol–1–yl)piperidine–1–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(6-bromobenzimidazol-1-yl)piperidine-1-carboxylate (CAS 1374145-59-1) is a chemical compound with the molecular formula C17H22BrN3O2 and a molecular weight of 380.3 g/mol. IUPAC name: tert-butyl 4-(6-bromobenzimidazol-1-yl)piperidine-1-carboxylate. InChIKey: KLWPTGYPZJNBOD-UHFFFAOYSA-N.

Identity
Molecular formulaC17H22BrN3O2
Molecular weight380.3 g/mol
IUPAC nametert-butyl 4-(6-bromobenzimidazol-1-yl)piperidine-1-carboxylate
InChIKeyKLWPTGYPZJNBOD-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)N2C=NC3=C2C=C(C=C3)Br

Computed by PubChem (NCBI)