Products 1374244-70-8

CAS 1374244-70-8 is the registry number for 4-((Pyridin-2-yldisulfaneyl)methyl)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.

Structural formula: {0} (CAS {1})

4-[(pyridin-2-yldisulfanyl)methyl]benzoic acid (CAS 1374244-70-8) is a chemical compound with the molecular formula C13H11NO2S2 and a molecular weight of 277.4 g/mol. IUPAC name: 4-[(pyridin-2-yldisulfanyl)methyl]benzoic acid. InChIKey: TWZRWZICWFYVDV-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11NO2S2
Molecular weight277.4 g/mol
IUPAC name4-[(pyridin-2-yldisulfanyl)methyl]benzoic acid
InChIKeyTWZRWZICWFYVDV-UHFFFAOYSA-N
SMILESC1=CC=NC(=C1)SSCC2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)