CAS 1374244-70-8 is the registry number for 4-((Pyridin-2-yldisulfaneyl)methyl)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
4-[(pyridin-2-yldisulfanyl)methyl]benzoic acid (CAS 1374244-70-8) is a chemical compound with the molecular formula C13H11NO2S2 and a molecular weight of 277.4 g/mol. IUPAC name: 4-[(pyridin-2-yldisulfanyl)methyl]benzoic acid. InChIKey: TWZRWZICWFYVDV-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2S2 |
|---|---|
| Molecular weight | 277.4 g/mol |
| IUPAC name | 4-[(pyridin-2-yldisulfanyl)methyl]benzoic acid |
| InChIKey | TWZRWZICWFYVDV-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)SSCC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)