CAS 1374250-07-3 appears in our catalog under these names: 3’-Anhydro Ezetimibe Alcohol Impurity, Ezetimibe Lactam Cleaved Alcohol, Ezetimibe Impurity 43. Offered by: TRC, Chemat Brand. Available pack sizes: 10mg, 1mg, 2,5mg, on request.
4-[(E,1S,2R)-1-(4-fluoroanilino)-5-(4-fluorophenyl)-2-(hydroxymethyl)pent-4-enyl]phenol (CAS 1374250-07-3) is a chemical compound with the molecular formula C24H23F2NO2 and a molecular weight of 395.4 g/mol. IUPAC name: 4-[(E,1S,2R)-1-(4-fluoroanilino)-5-(4-fluorophenyl)-2-(hydroxymethyl)pent-4-enyl]phenol. InChIKey: IGXOLFHCRMDQKD-RNXITGHGSA-N.
| Molecular formula | C24H23F2NO2 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | 4-[(E,1S,2R)-1-(4-fluoroanilino)-5-(4-fluorophenyl)-2-(hydroxymethyl)pent-4-enyl]phenol |
| InChIKey | IGXOLFHCRMDQKD-RNXITGHGSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C[C@@H](CO)[C@@H](C2=CC=C(C=C2)O)NC3=CC=C(C=C3)F)F |
Computed by PubChem (NCBI)