CAS 1374320-97-4 is the registry number for 2-Methyl-3-(methylthio)propanoic Acid-d3. Offered by: TRC. Available pack sizes: 100mg.
2,3,3-trideuterio-2-methyl-3-methylsulfanylpropanoic acid (CAS 1374320-97-4) is a chemical compound with the molecular formula C5H10O2S and a molecular weight of 137.22 g/mol. IUPAC name: 2,3,3-trideuterio-2-methyl-3-methylsulfanylpropanoic acid. InChIKey: LJGHYEQLQGHZJS-FBYXXYQPSA-N.
| Molecular formula | C5H10O2S |
|---|---|
| Molecular weight | 137.22 g/mol |
| IUPAC name | 2,3,3-trideuterio-2-methyl-3-methylsulfanylpropanoic acid |
| InChIKey | LJGHYEQLQGHZJS-FBYXXYQPSA-N |
| SMILES | [2H]C([2H])(C([2H])(C)C(=O)O)SC |
Computed by PubChem (NCBI)