CAS 1374337-37-7 is the registry number for [2,2'-Binaphthalen]-7-yl trifluoromethanesulfonate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(7-naphthalen-2-ylnaphthalen-2-yl) trifluoromethanesulfonate (CAS 1374337-37-7) is a chemical compound with the molecular formula C21H13F3O3S and a molecular weight of 402.4 g/mol. IUPAC name: (7-naphthalen-2-ylnaphthalen-2-yl) trifluoromethanesulfonate. InChIKey: ZCMSYUCVHSYAIS-UHFFFAOYSA-N.
| Molecular formula | C21H13F3O3S |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | (7-naphthalen-2-ylnaphthalen-2-yl) trifluoromethanesulfonate |
| InChIKey | ZCMSYUCVHSYAIS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=CC4=C(C=C3)C=CC(=C4)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)