CAS 137434-04-9 appears in our catalog under these names: 6-Bromo-2,2-dimethyl-1,2-dihydroquinoline, 97%, 6-bromo-2,2-dimethyl-1H-quinoline, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
6-bromo-2,2-dimethyl-1H-quinoline (CAS 137434-04-9) is a chemical compound with the molecular formula C11H12BrN and a molecular weight of 238.12 g/mol. IUPAC name: 6-bromo-2,2-dimethyl-1H-quinoline. InChIKey: SIPXJEMABNJWKO-UHFFFAOYSA-N.
| Molecular formula | C11H12BrN |
|---|---|
| Molecular weight | 238.12 g/mol |
| IUPAC name | 6-bromo-2,2-dimethyl-1H-quinoline |
| InChIKey | SIPXJEMABNJWKO-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(N1)C=CC(=C2)Br)C |
Computed by PubChem (NCBI)