Products 13745-19-2

CAS 13745-19-2 is the registry number for 3-Bromo-1,4-dimethyl-1H-pyrazole-5-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-bromo-1,4-dimethylpyrazole-5-carboxylic acid (CAS 13745-19-2) is a chemical compound with the molecular formula C6H7BrN2O2 and a molecular weight of 219.04 g/mol. IUPAC name: 3-bromo-1,4-dimethylpyrazole-5-carboxylic acid. InChIKey: VIBCDHZCTPIMHR-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7BrN2O2
Molecular weight219.04 g/mol
IUPAC name3-bromo-1,4-dimethylpyrazole-5-carboxylic acid
InChIKeyVIBCDHZCTPIMHR-UHFFFAOYSA-N
SMILESCC1=C(N(N=C1Br)C)C(=O)O

Computed by PubChem (NCBI)