Products 1374509-46-2
CAS 1374509-46-2 is the registry number for rac-((1R,2R)-2-(Furan-2-yl)cyclopropyl)methanamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[(1R,2R)-2-(furan-2-yl)cyclopropyl]methanamine (CAS 1374509-46-2) is a chemical compound with the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. IUPAC name: [(1R,2R)-2-(furan-2-yl)cyclopropyl]methanamine. InChIKey: BLCMHHXNGQBHQM-NKWVEPMBSA-N.
| Molecular formula | C8H11NO |
|---|---|
| Molecular weight | 137.18 g/mol |
| IUPAC name | [(1R,2R)-2-(furan-2-yl)cyclopropyl]methanamine |
| InChIKey | BLCMHHXNGQBHQM-NKWVEPMBSA-N |
| SMILES | C1[C@H]([C@@H]1C2=CC=CO2)CN |
Computed by PubChem (NCBI)