CAS 1374509-75-7 is the registry number for 4-(Bromomethyl)-1-(4-fluorobenzoyl)-2,2-dimethyl-1,2-dihydroquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[4-(bromomethyl)-2,2-dimethylquinolin-1-yl]-(4-fluorophenyl)methanone (CAS 1374509-75-7) is a chemical compound with the molecular formula C19H17BrFNO and a molecular weight of 374.2 g/mol. IUPAC name: [4-(bromomethyl)-2,2-dimethylquinolin-1-yl]-(4-fluorophenyl)methanone. InChIKey: HIXWQCJXFAZGGJ-UHFFFAOYSA-N.
| Molecular formula | C19H17BrFNO |
|---|---|
| Molecular weight | 374.2 g/mol |
| IUPAC name | [4-(bromomethyl)-2,2-dimethylquinolin-1-yl]-(4-fluorophenyl)methanone |
| InChIKey | HIXWQCJXFAZGGJ-UHFFFAOYSA-N |
| SMILES | CC1(C=C(C2=CC=CC=C2N1C(=O)C3=CC=C(C=C3)F)CBr)C |
Computed by PubChem (NCBI)