CAS 137453-25-9 is the registry number for Isoindoline-5-carboxamide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2,3-dihydro-1H-isoindole-5-carboxamide (CAS 137453-25-9) is a chemical compound with the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. IUPAC name: 2,3-dihydro-1H-isoindole-5-carboxamide. InChIKey: DZACPFIVEGYGNL-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O |
|---|---|
| Molecular weight | 162.19 g/mol |
| IUPAC name | 2,3-dihydro-1H-isoindole-5-carboxamide |
| InChIKey | DZACPFIVEGYGNL-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1)C=C(C=C2)C(=O)N |
Computed by PubChem (NCBI)