CAS 1374641-73-2 is the registry number for tert-Butyl (3-((2,5-dichloropyrimidin-4-yl)oxy)phenyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[3-(2,5-dichloropyrimidin-4-yl)oxyphenyl]carbamate (CAS 1374641-73-2) is a chemical compound with the molecular formula C15H15Cl2N3O3 and a molecular weight of 356.2 g/mol. IUPAC name: tert-butyl N-[3-(2,5-dichloropyrimidin-4-yl)oxyphenyl]carbamate. InChIKey: YQTPHLCTJGWTIH-UHFFFAOYSA-N.
| Molecular formula | C15H15Cl2N3O3 |
|---|---|
| Molecular weight | 356.2 g/mol |
| IUPAC name | tert-butyl N-[3-(2,5-dichloropyrimidin-4-yl)oxyphenyl]carbamate |
| InChIKey | YQTPHLCTJGWTIH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=CC=C1)OC2=NC(=NC=C2Cl)Cl |
Computed by PubChem (NCBI)