CAS 1374651-66-7 is the registry number for 7-Bromo-6-methoxy-1H-indazole, 97%. Offered by: AmBeed. Available pack sizes: 100mg, 1g.
7-bromo-6-methoxy-1H-indazole (CAS 1374651-66-7) is a chemical compound with the molecular formula C8H7BrN2O and a molecular weight of 227.06 g/mol. IUPAC name: 7-bromo-6-methoxy-1H-indazole. InChIKey: CDNNAGDQXPYXMO-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | 7-bromo-6-methoxy-1H-indazole |
| InChIKey | CDNNAGDQXPYXMO-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C=NN2)Br |
Computed by PubChem (NCBI)