CAS 1374654-17-7 is the registry number for (2R,3S)-2-Methylpiperidine-3-carbonitrile hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
(2R,3S)-2-methylpiperidine-3-carbonitrile;hydrochloride (CAS 1374654-17-7) is a chemical compound with the molecular formula C7H13ClN2 and a molecular weight of 160.64 g/mol. IUPAC name: (2R,3S)-2-methylpiperidine-3-carbonitrile;hydrochloride. InChIKey: CSOJWRCWBSATFZ-ZJLYAJKPSA-N.
| Molecular formula | C7H13ClN2 |
|---|---|
| Molecular weight | 160.64 g/mol |
| IUPAC name | (2R,3S)-2-methylpiperidine-3-carbonitrile;hydrochloride |
| InChIKey | CSOJWRCWBSATFZ-ZJLYAJKPSA-N |
| SMILES | C[C@@H]1[C@H](CCCN1)C#N.Cl |
Computed by PubChem (NCBI)