CAS 1374669-63-2 appears in our catalog under these names: (R)–1–Benzyl 4–tert–butyl 2–cyanopiperazine–1,4–dicarboxylate, (R)-1-Benzyl 4-tert-butyl 2-cyanopiperazine-1,4-dicarboxylate 97%, 1,4-Piperazinedicarboxylic acid, 2-cyano-, 4-(1,1-dimethylethyl) 1-(phenylmethyl) ester, (2R)-, 97%, 97%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g.
1-O-benzyl 4-O-tert-butyl (2R)-2-cyanopiperazine-1,4-dicarboxylate (CAS 1374669-63-2) is a chemical compound with the molecular formula C18H23N3O4 and a molecular weight of 345.4 g/mol. IUPAC name: 1-O-benzyl 4-O-tert-butyl (2R)-2-cyanopiperazine-1,4-dicarboxylate. InChIKey: INPROUMRGMMTSE-HNNXBMFYSA-N.
| Molecular formula | C18H23N3O4 |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | 1-O-benzyl 4-O-tert-butyl (2R)-2-cyanopiperazine-1,4-dicarboxylate |
| InChIKey | INPROUMRGMMTSE-HNNXBMFYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@H](C1)C#N)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)