CAS 1374673-93-4 appears in our catalog under these names: (S)–tert–butyl 2–Methyl–4–oxopyrrolidine–1–carboxylate, (S)-tert-Butyl 2-Methyl-4-oxopyrrolidine-1-carboxylate 95%, 1-Pyrrolidinecarboxylic acid, 2-methyl-4-oxo-, 1,1-dimethylethyl ester, (2S)-, 97%, 97%, TERT-BUTYL (S)-2-METHYL-4-OXOPYRROLIDINE-1-CARBOXYLATE, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 500mg, 10g.
Tert-butyl (2S)-2-methyl-4-oxopyrrolidine-1-carboxylate (CAS 1374673-93-4) is a chemical compound with the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. IUPAC name: tert-butyl (2S)-2-methyl-4-oxopyrrolidine-1-carboxylate. InChIKey: ABBMDHUKQONVIE-ZETCQYMHSA-N.
| Molecular formula | C10H17NO3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | tert-butyl (2S)-2-methyl-4-oxopyrrolidine-1-carboxylate |
| InChIKey | ABBMDHUKQONVIE-ZETCQYMHSA-N |
| SMILES | C[C@H]1CC(=O)CN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)