Products 1374754-16-1
CAS 1374754-16-1 is the registry number for 2,6-Bis((S)-4-(tert-butyl)-4,5-dihydrooxazol-2-yl)pyridin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-bis[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]pyridin-4-amine (CAS 1374754-16-1) is a chemical compound with the molecular formula C19H28N4O2 and a molecular weight of 344.5 g/mol. IUPAC name: 2,6-bis[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]pyridin-4-amine. InChIKey: OKRLBWSUPBEUKP-HUUCEWRRSA-N.
| Molecular formula | C19H28N4O2 |
|---|---|
| Molecular weight | 344.5 g/mol |
| IUPAC name | 2,6-bis[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]pyridin-4-amine |
| InChIKey | OKRLBWSUPBEUKP-HUUCEWRRSA-N |
| SMILES | CC(C)(C)[C@H]1COC(=N1)C2=CC(=CC(=N2)C3=N[C@H](CO3)C(C)(C)C)N |
Computed by PubChem (NCBI)