Products 1374984-64-1

CAS 1374984-64-1 is the registry number for 6-Azido-a-D-galactose-1-dihydrogenphosphate. Offered by: Biosynth. Available pack sizes: 5mg, 2mg, 10mg, 50mg, 25mg.

Structural formula: {0} (CAS {1})

[(2R,4R,5R)-6-(azidomethyl)-3,4,5-trihydroxyoxan-2-yl] dihydrogen phosphate (CAS 1374984-64-1) is a chemical compound with the molecular formula C6H12N3O8P and a molecular weight of 285.15 g/mol. IUPAC name: [(2R,4R,5R)-6-(azidomethyl)-3,4,5-trihydroxyoxan-2-yl] dihydrogen phosphate. InChIKey: KBAKEEAIYVELKC-NNGXUUBWSA-N.

Identity
Molecular formulaC6H12N3O8P
Molecular weight285.15 g/mol
IUPAC name[(2R,4R,5R)-6-(azidomethyl)-3,4,5-trihydroxyoxan-2-yl] dihydrogen phosphate
InChIKeyKBAKEEAIYVELKC-NNGXUUBWSA-N
SMILESC(C1[C@@H]([C@H](C([C@H](O1)OP(=O)(O)O)O)O)O)N=[N+]=[N-]

Computed by PubChem (NCBI)