CAS 1374984-75-4 is the registry number for BVT173187, 99.97%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 50 mg, 25 mg, 5 mg, 10 mg.
3,5-dichloro-N-(2-chloro-5-methylphenyl)-2-hydroxybenzamide (CAS 1374984-75-4) is a chemical compound with the molecular formula C14H10Cl3NO2 and a molecular weight of 330.6 g/mol. IUPAC name: 3,5-dichloro-N-(2-chloro-5-methylphenyl)-2-hydroxybenzamide. InChIKey: UCOQCHLODZCXRH-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl3NO2 |
|---|---|
| Molecular weight | 330.6 g/mol |
| IUPAC name | 3,5-dichloro-N-(2-chloro-5-methylphenyl)-2-hydroxybenzamide |
| InChIKey | UCOQCHLODZCXRH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)Cl)NC(=O)C2=C(C(=CC(=C2)Cl)Cl)O |
Computed by PubChem (NCBI)