Products 1375008-18-6
CAS 1375008-18-6 is the registry number for 1-Methylethyl 2-(4-iodophenoxy)-2-methylpropanoate, 95%. Offered by: Chemat. Available pack sizes: 100mg.
Propan-2-yl 2-(4-iodophenoxy)-2-methylpropanoate (CAS 1375008-18-6) is a chemical compound with the molecular formula C13H17IO3 and a molecular weight of 348.18 g/mol. IUPAC name: propan-2-yl 2-(4-iodophenoxy)-2-methylpropanoate. InChIKey: YPMKNJOMGTUZEE-UHFFFAOYSA-N.
| Molecular formula | C13H17IO3 |
|---|---|
| Molecular weight | 348.18 g/mol |
| IUPAC name | propan-2-yl 2-(4-iodophenoxy)-2-methylpropanoate |
| InChIKey | YPMKNJOMGTUZEE-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C(C)(C)OC1=CC=C(C=C1)I |
Computed by PubChem (NCBI)