CAS 1375068-63-5 is the registry number for 3-Amino-5-bromo-N-cyclohexylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-amino-5-bromo-N-cyclohexylbenzamide (CAS 1375068-63-5) is a chemical compound with the molecular formula C13H17BrN2O and a molecular weight of 297.19 g/mol. IUPAC name: 3-amino-5-bromo-N-cyclohexylbenzamide. InChIKey: SKMCBDBBDHSJOH-UHFFFAOYSA-N.
| Molecular formula | C13H17BrN2O |
|---|---|
| Molecular weight | 297.19 g/mol |
| IUPAC name | 3-amino-5-bromo-N-cyclohexylbenzamide |
| InChIKey | SKMCBDBBDHSJOH-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)C2=CC(=CC(=C2)Br)N |
Computed by PubChem (NCBI)