Products 1375068-91-9
CAS 1375068-91-9 is the registry number for {4-[4-Fluoro-3-(trifluoromethyl)phenyl]phenyl}acetic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-[4-[4-fluoro-3-(trifluoromethyl)phenyl]phenyl]acetic acid (CAS 1375068-91-9) is a chemical compound with the molecular formula C15H10F4O2 and a molecular weight of 298.23 g/mol. IUPAC name: 2-[4-[4-fluoro-3-(trifluoromethyl)phenyl]phenyl]acetic acid. InChIKey: QQHJXFAZDSMKFW-UHFFFAOYSA-N.
| Molecular formula | C15H10F4O2 |
|---|---|
| Molecular weight | 298.23 g/mol |
| IUPAC name | 2-[4-[4-fluoro-3-(trifluoromethyl)phenyl]phenyl]acetic acid |
| InChIKey | QQHJXFAZDSMKFW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)O)C2=CC(=C(C=C2)F)C(F)(F)F |
Computed by PubChem (NCBI)