CAS 1375068-98-6 is the registry number for 3-[(3-Methylbutane)sulfonyl]aniline, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
3-(3-methylbutylsulfonyl)aniline (CAS 1375068-98-6) is a chemical compound with the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. IUPAC name: 3-(3-methylbutylsulfonyl)aniline. InChIKey: BPPLBTGXTYNCCN-UHFFFAOYSA-N.
| Molecular formula | C11H17NO2S |
|---|---|
| Molecular weight | 227.33 g/mol |
| IUPAC name | 3-(3-methylbutylsulfonyl)aniline |
| InChIKey | BPPLBTGXTYNCCN-UHFFFAOYSA-N |
| SMILES | CC(C)CCS(=O)(=O)C1=CC=CC(=C1)N |
Computed by PubChem (NCBI)