CAS 1375069-04-7 is the registry number for 6-Bromo-7-chloro-8-fluoroquinoline, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
6-bromo-7-chloro-8-fluoroquinoline (CAS 1375069-04-7) is a chemical compound with the molecular formula C9H4BrClFN and a molecular weight of 260.49 g/mol. IUPAC name: 6-bromo-7-chloro-8-fluoroquinoline. InChIKey: QHMLGOVAVIKSDC-UHFFFAOYSA-N.
| Molecular formula | C9H4BrClFN |
|---|---|
| Molecular weight | 260.49 g/mol |
| IUPAC name | 6-bromo-7-chloro-8-fluoroquinoline |
| InChIKey | QHMLGOVAVIKSDC-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(C(=C2N=C1)F)Cl)Br |
Computed by PubChem (NCBI)