Products 1375069-31-0

CAS 1375069-31-0 is the registry number for {3-[4-(Ethylcarbamoyl)-3-fluorophenyl]phenyl}acetic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-[3-[4-(ethylcarbamoyl)-3-fluorophenyl]phenyl]acetic acid (CAS 1375069-31-0) is a chemical compound with the molecular formula C17H16FNO3 and a molecular weight of 301.31 g/mol. IUPAC name: 2-[3-[4-(ethylcarbamoyl)-3-fluorophenyl]phenyl]acetic acid. InChIKey: YKGMKTLRMXMEOM-UHFFFAOYSA-N.

Identity
Molecular formulaC17H16FNO3
Molecular weight301.31 g/mol
IUPAC name2-[3-[4-(ethylcarbamoyl)-3-fluorophenyl]phenyl]acetic acid
InChIKeyYKGMKTLRMXMEOM-UHFFFAOYSA-N
SMILESCCNC(=O)C1=C(C=C(C=C1)C2=CC=CC(=C2)CC(=O)O)F

Computed by PubChem (NCBI)