Products 1375191-46-0

CAS 1375191-46-0 is the registry number for tert-Butyl 4-(azetidine-3-sulfonyl)piperazine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(azetidin-3-ylsulfonyl)piperazine-1-carboxylate (CAS 1375191-46-0) is a chemical compound with the molecular formula C12H23N3O4S and a molecular weight of 305.40 g/mol. IUPAC name: tert-butyl 4-(azetidin-3-ylsulfonyl)piperazine-1-carboxylate. InChIKey: FOAFVBYHCRHASF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H23N3O4S
Molecular weight305.40 g/mol
IUPAC nametert-butyl 4-(azetidin-3-ylsulfonyl)piperazine-1-carboxylate
InChIKeyFOAFVBYHCRHASF-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCN(CC1)S(=O)(=O)C2CNC2

Computed by PubChem (NCBI)