CAS 1375224-55-7 is the registry number for Panowamycin A. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3S)-3-[(1S,3R,4S)-1-(2-hydroxyethyl)-4,7-dimethyl-3,4-dihydro-1H-isochromen-3-yl]butan-2-one (CAS 1375224-55-7) is a chemical compound with the molecular formula C17H24O3 and a molecular weight of 276.4 g/mol. IUPAC name: (3S)-3-[(1S,3R,4S)-1-(2-hydroxyethyl)-4,7-dimethyl-3,4-dihydro-1H-isochromen-3-yl]butan-2-one. InChIKey: BQFJLNBRBAHACW-YIFBXAAPSA-N.
| Molecular formula | C17H24O3 |
|---|---|
| Molecular weight | 276.4 g/mol |
| IUPAC name | (3S)-3-[(1S,3R,4S)-1-(2-hydroxyethyl)-4,7-dimethyl-3,4-dihydro-1H-isochromen-3-yl]butan-2-one |
| InChIKey | BQFJLNBRBAHACW-YIFBXAAPSA-N |
| SMILES | C[C@@H]1[C@@H](O[C@H](C2=C1C=CC(=C2)C)CCO)[C@H](C)C(=O)C |
Computed by PubChem (NCBI)