CAS 1375302-81-0 is the registry number for 2,4-Dichloro-6-(trifluoromethyl)-1,3,5-triazine, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
2,4-dichloro-6-(trifluoromethyl)-1,3,5-triazine (CAS 1375302-81-0) is a chemical compound with the molecular formula C4Cl2F3N3 and a molecular weight of 217.96 g/mol. IUPAC name: 2,4-dichloro-6-(trifluoromethyl)-1,3,5-triazine. InChIKey: WDKAIRUWWMHPJW-UHFFFAOYSA-N.
| Molecular formula | C4Cl2F3N3 |
|---|---|
| Molecular weight | 217.96 g/mol |
| IUPAC name | 2,4-dichloro-6-(trifluoromethyl)-1,3,5-triazine |
| InChIKey | WDKAIRUWWMHPJW-UHFFFAOYSA-N |
| SMILES | C1(=NC(=NC(=N1)Cl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)