CAS 13754-56-8 appears in our catalog under these names: Promethazine Sulfone, Dioxopromethazine, 99%, 1–(5,5–dioxophenothiazin–10–yl)–N,N–dimethylpropan–2–amine, Dioxopromethazine, Dioxopromethazine, ≥98%, ≥98%. Offered by: Chemat Brand, AmBeed, TRC, GLPBio, TargetMol. Available pack sizes: on request, 5g, 100mg, 2,5mg, 25mg, 25g, 200mg, 10 mg.
1-(5,5-dioxophenothiazin-10-yl)-N,N-dimethylpropan-2-amine (CAS 13754-56-8) is a chemical compound with the molecular formula C17H20N2O2S and a molecular weight of 316.4 g/mol. IUPAC name: 1-(5,5-dioxophenothiazin-10-yl)-N,N-dimethylpropan-2-amine. InChIKey: FDXKCOBAFGSMDJ-UHFFFAOYSA-N.
| Molecular formula | C17H20N2O2S |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 1-(5,5-dioxophenothiazin-10-yl)-N,N-dimethylpropan-2-amine |
| InChIKey | FDXKCOBAFGSMDJ-UHFFFAOYSA-N |
| SMILES | CC(CN1C2=CC=CC=C2S(=O)(=O)C3=CC=CC=C31)N(C)C |
Computed by PubChem (NCBI)