CAS 1375466-18-4 appears in our catalog under these names: Acy-775, 95%, ACY-775, ACY–775, ACY-775 99%, 2-((1-(3-Fluorophenyl)cyclohexyl)amino)-N-hydroxypyrimidine-5-carboxamide, 99%, 99%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 100mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg.
2-[[1-(3-fluorophenyl)cyclohexyl]amino]-N-hydroxypyrimidine-5-carboxamide (CAS 1375466-18-4) is a chemical compound with the molecular formula C17H19FN4O2 and a molecular weight of 330.36 g/mol. IUPAC name: 2-[[1-(3-fluorophenyl)cyclohexyl]amino]-N-hydroxypyrimidine-5-carboxamide. InChIKey: IYBURCQQEUNLDL-UHFFFAOYSA-N.
| Molecular formula | C17H19FN4O2 |
|---|---|
| Molecular weight | 330.36 g/mol |
| IUPAC name | 2-[[1-(3-fluorophenyl)cyclohexyl]amino]-N-hydroxypyrimidine-5-carboxamide |
| InChIKey | IYBURCQQEUNLDL-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=CC(=CC=C2)F)NC3=NC=C(C=N3)C(=O)NO |
Computed by PubChem (NCBI)