CAS 1375471-65-0 is the registry number for Methyl 2-{1-((chlorosulfonyl)methyl)cyclopropyl}acetate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 2-[1-(chlorosulfonylmethyl)cyclopropyl]acetate (CAS 1375471-65-0) is a chemical compound with the molecular formula C7H11ClO4S and a molecular weight of 226.68 g/mol. IUPAC name: methyl 2-[1-(chlorosulfonylmethyl)cyclopropyl]acetate. InChIKey: XKJRXBCSVFYXRD-UHFFFAOYSA-N.
| Molecular formula | C7H11ClO4S |
|---|---|
| Molecular weight | 226.68 g/mol |
| IUPAC name | methyl 2-[1-(chlorosulfonylmethyl)cyclopropyl]acetate |
| InChIKey | XKJRXBCSVFYXRD-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1(CC1)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)