CAS 1375473-10-1 is the registry number for 4-Hydrazinyl-N-(1,3-thiazol-2-yl)benzene-1-sulfonamide dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-hydrazinyl-N-(1,3-thiazol-2-yl)benzenesulfonamide;dihydrochloride (CAS 1375473-10-1) is a chemical compound with the molecular formula C9H12Cl2N4O2S2 and a molecular weight of 343.3 g/mol. IUPAC name: 4-hydrazinyl-N-(1,3-thiazol-2-yl)benzenesulfonamide;dihydrochloride. InChIKey: VOKGJWDSRLHHEA-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N4O2S2 |
|---|---|
| Molecular weight | 343.3 g/mol |
| IUPAC name | 4-hydrazinyl-N-(1,3-thiazol-2-yl)benzenesulfonamide;dihydrochloride |
| InChIKey | VOKGJWDSRLHHEA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NN)S(=O)(=O)NC2=NC=CS2.Cl.Cl |
Computed by PubChem (NCBI)